C16H28O2Si — CID 134900317
[(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134900317) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is [(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134900317 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [(5R,7aS)-5-methyl-1,3,5,7a-tetrahydro-2-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1C=C[C@@H]2COCC2=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-12-7-8-13-9-17-10-15(13)14(12)11-18-19(5,6)16(2,3)4/h7-8,12-13H,9-11H2,1-6H3/t12-,13-/m1/s1 |
| InChIKey | CSQKCVMVKUYPLK-CHWSQXEVSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|