C17H22O2 — CID 10753702
(3aS)-7-[(E)-3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-enyl]-1,3,3a,6-tetrahydro-2-benzofuran (PubChem CID 10753702) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3aS)-7-[(E)-3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-enyl]-1,3,3a,6-tetrahydro-2-benzofuran.
| Compound Name | (3aS)-7-[(E)-3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-enyl]-1,3,3a,6-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 10753702 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (3aS)-7-[(E)-3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-enyl]-1,3,3a,6-tetrahydro-2-benzofuran |
| SMILES | C/C=C/C=C/COC/C=C/C1=C2COC[C@H]2C=CC1 |
| InChI | InChI=1S/C17H22O2/c1-2-3-4-5-11-18-12-7-10-15-8-6-9-16-13-19-14-17(15)16/h2-7,9-10,16H,8,11-14H2,1H3/b3-2+,5-4+,10-7+/t16-/m1/s1 |
| InChIKey | ZKVHVJCWEKCWTQ-DRERAEFFSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|