C14H20O — CID 101190188
(3aS,4Z,6R,7Z,9E)-6-methyl-8-propyl-1,3,3a,6-tetrahydrocycloocta[c]furan (PubChem CID 101190188) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (3aS,4Z,6R,7Z,9E)-6-methyl-8-propyl-1,3,3a,6-tetrahydrocycloocta[c]furan.
| Compound Name | (3aS,4Z,6R,7Z,9E)-6-methyl-8-propyl-1,3,3a,6-tetrahydrocycloocta[c]furan |
|---|---|
| PubChem CID | 101190188 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (3aS,4Z,6R,7Z,9E)-6-methyl-8-propyl-1,3,3a,6-tetrahydrocycloocta[c]furan |
| SMILES | CCCC1=C/[C@H](C)/C=C\[C@@H]2COC\C2=C\1 |
| InChI | InChI=1S/C14H20O/c1-3-4-12-7-11(2)5-6-13-9-15-10-14(13)8-12/h5-8,11,13H,3-4,9-10H2,1-2H3/b6-5-,12-7-,14-8-/t11-,13-/m1/s1 |
| InChIKey | NODHBZVGDPLNPV-KCAZLYHVSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|