C10H16O — CID 14379831
(2S,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane (PubChem CID 14379831) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2S,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane.
| Compound Name | (2S,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane |
|---|---|
| PubChem CID | 14379831 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2S,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane |
| SMILES | C=C(C)/C=C/[C@@H]1C[C@@H](C)CO1 |
| InChI | InChI=1S/C10H16O/c1-8(2)4-5-10-6-9(3)7-11-10/h4-5,9-10H,1,6-7H2,2-3H3/b5-4+/t9-,10-/m1/s1 |
| InChIKey | SULWOTZUSYCRIP-NUNSBDKSSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|