C13H21FO — CID 142308970
(2E,4Z)-3-(2-fluoroethoxymethyl)-7-methyl-6-methylideneocta-2,4-diene (PubChem CID 142308970) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is (2E,4Z)-3-(2-fluoroethoxymethyl)-7-methyl-6-methylideneocta-2,4-diene.
| Compound Name | (2E,4Z)-3-(2-fluoroethoxymethyl)-7-methyl-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 142308970 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (2E,4Z)-3-(2-fluoroethoxymethyl)-7-methyl-6-methylideneocta-2,4-diene |
| SMILES | C=C(/C=C\C(=C/C)COCCF)C(C)C |
| InChI | InChI=1S/C13H21FO/c1-5-13(10-15-9-8-14)7-6-12(4)11(2)3/h5-7,11H,4,8-10H2,1-3H3/b7-6-,13-5+ |
| InChIKey | OVXIBTJROJVRFY-ZQNRWWJISA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|