C15H27FO — CID 88998018
(2E,4Z)-3-[(2R)-2-fluoro-2-methylbutoxy]-6,7-dimethylocta-2,4-diene (PubChem CID 88998018) has the molecular formula C15H27FO and a molecular weight of 242.38 g/mol. Its IUPAC name is (2E,4Z)-3-[(2R)-2-fluoro-2-methylbutoxy]-6,7-dimethylocta-2,4-diene.
| Compound Name | (2E,4Z)-3-[(2R)-2-fluoro-2-methylbutoxy]-6,7-dimethylocta-2,4-diene |
|---|---|
| PubChem CID | 88998018 |
| Molecular Formula | C15H27FO |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2E,4Z)-3-[(2R)-2-fluoro-2-methylbutoxy]-6,7-dimethylocta-2,4-diene |
| SMILES | C/C=C(\C=C/C(C)C(C)C)OC[C@](C)(F)CC |
| InChI | InChI=1S/C15H27FO/c1-7-14(10-9-13(5)12(3)4)17-11-15(6,16)8-2/h7,9-10,12-13H,8,11H2,1-6H3/b10-9-,14-7+/t13?,15-/m1/s1 |
| InChIKey | KXPDZGJMPUBABE-YEFVBRAMSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|