C11H16F2O — CID 89381334
(3Z,5Z)-7-(1,1-difluoroethoxy)-4-ethylhepta-1,3,5-triene (PubChem CID 89381334) has the molecular formula C11H16F2O and a molecular weight of 202.24 g/mol. Its IUPAC name is (3Z,5Z)-7-(1,1-difluoroethoxy)-4-ethylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-7-(1,1-difluoroethoxy)-4-ethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89381334 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (3Z,5Z)-7-(1,1-difluoroethoxy)-4-ethylhepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/COC(C)(F)F)CC |
| InChI | InChI=1S/C11H16F2O/c1-4-7-10(5-2)8-6-9-14-11(3,12)13/h4,6-8H,1,5,9H2,2-3H3/b8-6-,10-7- |
| InChIKey | LURZJZLFUAQATL-YOYBIJIWSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|