C15H24O2Si — CID 101190187
[(3aS,4Z,6R,7E,9E)-6-methyl-1,3,3a,6-tetrahydrocycloocta[c]furan-8-yl]methoxy-trimethylsilane (PubChem CID 101190187) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is [(3aS,4Z,6R,7E,9E)-6-methyl-1,3,3a,6-tetrahydrocycloocta[c]furan-8-yl]methoxy-trimethylsilane.
| Compound Name | [(3aS,4Z,6R,7E,9E)-6-methyl-1,3,3a,6-tetrahydrocycloocta[c]furan-8-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 101190187 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [(3aS,4Z,6R,7E,9E)-6-methyl-1,3,3a,6-tetrahydrocycloocta[c]furan-8-yl]methoxy-trimethylsilane |
| SMILES | C[C@@H]1/C=C\[C@@H]2COC/C2=C/C(CO[Si](C)(C)C)=C\1 |
| InChI | InChI=1S/C15H24O2Si/c1-12-5-6-14-10-16-11-15(14)8-13(7-12)9-17-18(2,3)4/h5-8,12,14H,9-11H2,1-4H3/b6-5-,13-7+,15-8-/t12-,14-/m1/s1 |
| InChIKey | MXNCUBDLFWOMNX-CFTGHESASA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|