C14H24O2Si — CID 134863591
tert-butyl-dimethyl-[(3E)-3-(4-methylideneoxolan-3-ylidene)prop-1-en-2-yl]oxysilane (PubChem CID 134863591) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E)-3-(4-methylideneoxolan-3-ylidene)prop-1-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3E)-3-(4-methylideneoxolan-3-ylidene)prop-1-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 134863591 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | tert-butyl-dimethyl-[(3E)-3-(4-methylideneoxolan-3-ylidene)prop-1-en-2-yl]oxysilane |
| SMILES | C=C(/C=C1/COCC1=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24O2Si/c1-11-9-15-10-13(11)8-12(2)16-17(6,7)14(3,4)5/h8H,1-2,9-10H2,3-7H3/b13-8- |
| InChIKey | JSFNTLPVAYLDQC-JYRVWZFOSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|