C13H22OSi — CID 101399599
[(5S,8aR)-4-methyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane (PubChem CID 101399599) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is [(5S,8aR)-4-methyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane.
| Compound Name | [(5S,8aR)-4-methyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101399599 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [(5S,8aR)-4-methyl-3,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-5-yl]-trimethylsilane |
| SMILES | CC1=C2COC[C@@H]2C=CC[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi/c1-10-12-9-14-8-11(12)6-5-7-13(10)15(2,3)4/h5-6,11,13H,7-9H2,1-4H3/t11-,13-/m0/s1 |
| InChIKey | OSPQJJKVWBAXBP-AAEUAGOBSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|