C26H32N6O2 — CID 101400139
3-[2-[2-(diethylamino)-5-methoxyindazol-3-yl]ethynyl]-N,N-diethyl-5-methoxyindazol-2-amine (PubChem CID 101400139) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[2-[2-(diethylamino)-5-methoxyindazol-3-yl]ethynyl]-N,N-diethyl-5-methoxyindazol-2-amine.
| Compound Name | 3-[2-[2-(diethylamino)-5-methoxyindazol-3-yl]ethynyl]-N,N-diethyl-5-methoxyindazol-2-amine |
|---|---|
| PubChem CID | 101400139 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 3-[2-[2-(diethylamino)-5-methoxyindazol-3-yl]ethynyl]-N,N-diethyl-5-methoxyindazol-2-amine |
| SMILES | CCN(CC)n1nc2ccc(OC)cc2c1C#Cc1c2cc(OC)ccc2nn1N(CC)CC |
| InChI | InChI=1S/C26H32N6O2/c1-7-29(8-2)31-25(21-17-19(33-5)11-13-23(21)27-31)15-16-26-22-18-20(34-6)12-14-24(22)28-32(26)30(9-3)10-4/h11-14,17-18H,7-10H2,1-6H3 |
| InChIKey | FLCWAZHFQYRQRZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|