C11H18O4 — CID 101400932
propan-2-yl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate (PubChem CID 101400932) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is propan-2-yl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate.
| Compound Name | propan-2-yl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate |
|---|---|
| PubChem CID | 101400932 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | propan-2-yl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate |
| SMILES | CC(C)OC(=O)/C(O)=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H18O4/c1-7(2)15-10(14)8(12)6-9(13)11(3,4)5/h6-7,12H,1-5H3/b8-6- |
| InChIKey | KSZCNIDCLZUDAR-VURMDHGXSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|