C26H42N4O11P+ — CID 101402209
2-[[(2R)-3-hexanoyloxy-2-[6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 101402209) has the molecular formula C26H42N4O11P+ and a molecular weight of 617.61 g/mol. Its IUPAC name is 2-[[(2R)-3-hexanoyloxy-2-[6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-hexanoyloxy-2-[6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 101402209 |
| Molecular Formula | C26H42N4O11P+ |
| Molecular Weight | 617.61 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 2-[[(2R)-3-hexanoyloxy-2-[6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C26H41N4O11P/c1-5-6-8-12-23(31)37-18-21(19-39-42(35,36)38-17-16-30(2,3)4)40-24(32)13-10-7-9-11-20-14-15-22(29(33)34)26-25(20)27-41-28-26/h14-15,21H,5-13,16-19H2,1-4H3/p+1/t21-/m1/s1 |
| InChIKey | YOUWQWHFGLHIDZ-OAQYLSRUSA-O |
| XLogP | 4.11 |
| TPSA | 190.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|