C38H65N5O11P+ — CID 54146187
2-[hydroxy-[(2R)-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]-3-octadec-9-enoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 54146187) has the molecular formula C38H65N5O11P+ and a molecular weight of 798.94 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]-3-octadec-9-enoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]-3-octadec-9-enoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 54146187 |
| Molecular Formula | C38H65N5O11P+ |
| Molecular Weight | 798.94 g/mol |
| Exact Mass | 798.44 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]-3-octadec-9-enoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C38H64N5O11P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23-35(44)50-30-32(31-52-55(48,49)51-29-28-43(2,3)4)53-36(45)24-21-19-22-27-39-33-25-26-34(42(46)47)38-37(33)40-54-41-38/h12-13,25-26,32H,5-11,14-24,27-31H2,1-4H3,(H-,39,41,48,49)/p+1/t32-/m1/s1 |
| InChIKey | OEOBAFBXLIMNCV-JGCGQSQUSA-O |
| XLogP | 8.44 |
| TPSA | 202.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.94 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|