C31H51N4O11P — CID 177451108
[(2R)-2-decanoyloxy-3-[hydroxy-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]phosphoryl]oxypropyl] decanoate (PubChem CID 177451108) has the molecular formula C31H51N4O11P and a molecular weight of 686.74 g/mol. Its IUPAC name is [(2R)-2-decanoyloxy-3-[hydroxy-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]phosphoryl]oxypropyl] decanoate.
| Compound Name | [(2R)-2-decanoyloxy-3-[hydroxy-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]phosphoryl]oxypropyl] decanoate |
|---|---|
| PubChem CID | 177451108 |
| Molecular Formula | C31H51N4O11P |
| Molecular Weight | 686.74 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | [(2R)-2-decanoyloxy-3-[hydroxy-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]phosphoryl]oxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCNc1ccc([N+](=O)[O-])c2nonc12)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C31H51N4O11P/c1-3-5-7-9-11-13-15-17-28(36)42-23-25(45-29(37)18-16-14-12-10-8-6-4-2)24-44-47(40,41)43-22-21-32-26-19-20-27(35(38)39)31-30(26)33-46-34-31/h19-20,25,32H,3-18,21-24H2,1-2H3,(H,40,41)/t25-/m1/s1 |
| InChIKey | PROCIEJWNNIJFL-RUZDIDTESA-N |
| XLogP | 7.41 |
| TPSA | 202.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|