C35H58N5O11P — CID 87377581
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]propyl] (Z)-octadec-9-enoate (PubChem CID 87377581) has the molecular formula C35H58N5O11P and a molecular weight of 755.85 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]propyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]propyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 87377581 |
| Molecular Formula | C35H58N5O11P |
| Molecular Weight | 755.85 g/mol |
| Exact Mass | 755.39 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyloxy]propyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C35H58N5O11P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-32(41)47-27-29(28-49-52(45,46)48-26-24-36)50-33(42)21-18-16-19-25-37-30-22-23-31(40(43)44)35-34(30)38-51-39-35/h9-10,22-23,29,37H,2-8,11-21,24-28,36H2,1H3,(H,45,46)/b10-9-/t29-/m1/s1 |
| InChIKey | QSCVAKOXJPISBN-MQGJRLHQSA-N |
| XLogP | 7.69 |
| TPSA | 228.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.85 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|