C10H11F3O2S — CID 101402310
2-[4-(trifluoromethylsulfanyl)phenyl]propane-1,2-diol (PubChem CID 101402310) has the molecular formula C10H11F3O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-[4-(trifluoromethylsulfanyl)phenyl]propane-1,2-diol.
| Compound Name | 2-[4-(trifluoromethylsulfanyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 101402310 |
| Molecular Formula | C10H11F3O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-[4-(trifluoromethylsulfanyl)phenyl]propane-1,2-diol |
| SMILES | CC(O)(CO)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3O2S/c1-9(15,6-14)7-2-4-8(5-3-7)16-10(11,12)13/h2-5,14-15H,6H2,1H3 |
| InChIKey | ZXIDVZMJBKXLNG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |