C23H19NO2 — CID 101403656
(4R,5S,8R)-7-benzyl-4-hydroxy-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),13,15-trien-2,11-diyn-6-one (PubChem CID 101403656) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (4R,5S,8R)-7-benzyl-4-hydroxy-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),13,15-trien-2,11-diyn-6-one.
| Compound Name | (4R,5S,8R)-7-benzyl-4-hydroxy-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),13,15-trien-2,11-diyn-6-one |
|---|---|
| PubChem CID | 101403656 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (4R,5S,8R)-7-benzyl-4-hydroxy-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),13,15-trien-2,11-diyn-6-one |
| SMILES | O=C1[C@H]2[C@@H](CCC#Cc3ccccc3C#C[C@@H]2O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H19NO2/c25-21-15-14-19-12-5-4-10-18(19)11-6-7-13-20-22(21)23(26)24(20)16-17-8-2-1-3-9-17/h1-5,8-10,12,20-22,25H,7,13,16H2/t20-,21+,22+/m1/s1 |
| InChIKey | DGPBWADGNBYQRJ-FSSWDIPSSA-N |
| XLogP | 2.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|