C25H23NO2 — CID 134847610
(6R,9R)-7-benzyl-12-oxa-7-azatricyclo[14.4.0.06,9]icosa-1(20),16,18-trien-2,14-diyn-8-one (PubChem CID 134847610) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is (6R,9R)-7-benzyl-12-oxa-7-azatricyclo[14.4.0.06,9]icosa-1(20),16,18-trien-2,14-diyn-8-one.
| Compound Name | (6R,9R)-7-benzyl-12-oxa-7-azatricyclo[14.4.0.06,9]icosa-1(20),16,18-trien-2,14-diyn-8-one |
|---|---|
| PubChem CID | 134847610 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (6R,9R)-7-benzyl-12-oxa-7-azatricyclo[14.4.0.06,9]icosa-1(20),16,18-trien-2,14-diyn-8-one |
| SMILES | O=C1[C@@H]2CCOCC#Cc3ccccc3C#CCC[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c27-25-23-16-18-28-17-8-14-22-12-5-4-11-21(22)13-6-7-15-24(23)26(25)19-20-9-2-1-3-10-20/h1-5,9-12,23-24H,7,15-19H2/t23-,24-/m1/s1 |
| InChIKey | WSXGLSWAUIUUQK-DNQXCXABSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|