C23H17NO — CID 134866541
(4E,8R)-7-benzyl-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),4,13,15-tetraen-2,11-diyn-6-one (PubChem CID 134866541) has the molecular formula C23H17NO and a molecular weight of 323.40 g/mol. Its IUPAC name is (4E,8R)-7-benzyl-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),4,13,15-tetraen-2,11-diyn-6-one.
| Compound Name | (4E,8R)-7-benzyl-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),4,13,15-tetraen-2,11-diyn-6-one |
|---|---|
| PubChem CID | 134866541 |
| Molecular Formula | C23H17NO |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (4E,8R)-7-benzyl-7-azatricyclo[11.4.0.05,8]heptadeca-1(17),4,13,15-tetraen-2,11-diyn-6-one |
| SMILES | O=C1/C2=C/C#Cc3ccccc3C#CCC[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C23H17NO/c25-23-21-15-8-14-20-12-5-4-11-19(20)13-6-7-16-22(21)24(23)17-18-9-2-1-3-10-18/h1-5,9-12,15,22H,7,16-17H2/b21-15+/t22-/m1/s1 |
| InChIKey | JUUQWWPJFBZOGO-ONQWYEKWSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|