C15H18O3 — CID 101404203
(1R,2S,4S,5S,8S,11Z,14R)-4,12-dimethyl-6-oxatetracyclo[6.5.1.02,4.05,14]tetradec-11-ene-7,13-dione (PubChem CID 101404203) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1R,2S,4S,5S,8S,11Z,14R)-4,12-dimethyl-6-oxatetracyclo[6.5.1.02,4.05,14]tetradec-11-ene-7,13-dione.
| Compound Name | (1R,2S,4S,5S,8S,11Z,14R)-4,12-dimethyl-6-oxatetracyclo[6.5.1.02,4.05,14]tetradec-11-ene-7,13-dione |
|---|---|
| PubChem CID | 101404203 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1R,2S,4S,5S,8S,11Z,14R)-4,12-dimethyl-6-oxatetracyclo[6.5.1.02,4.05,14]tetradec-11-ene-7,13-dione |
| SMILES | C/C1=C/CC[C@@H]2C(=O)O[C@H]3[C@@H]2[C@H](C1=O)[C@@H]1C[C@@]13C |
| InChI | InChI=1S/C15H18O3/c1-7-4-3-5-8-10-11(12(7)16)9-6-15(9,2)13(10)18-14(8)17/h4,8-11,13H,3,5-6H2,1-2H3/b7-4-/t8-,9-,10-,11+,13-,15-/m0/s1 |
| InChIKey | DTEGLWIVCXHONU-HCGZKGJPSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |