C15H18O3 — CID 102306506
(4S,6S,7S,9Z,13R)-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridec-9-ene-2,8-dione (PubChem CID 102306506) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4S,6S,7S,9Z,13R)-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridec-9-ene-2,8-dione.
| Compound Name | (4S,6S,7S,9Z,13R)-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 102306506 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4S,6S,7S,9Z,13R)-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridec-9-ene-2,8-dione |
| SMILES | C/C1=C/CCC23C(=O)O[C@H]4[C@@H]2[C@@H](C1=O)[C@H]3C4(C)C |
| InChI | InChI=1S/C15H18O3/c1-7-5-4-6-15-9-8(10(7)16)11(15)14(2,3)12(9)18-13(15)17/h5,8-9,11-12H,4,6H2,1-3H3/b7-5-/t8-,9-,11-,12-,15?/m0/s1 |
| InChIKey | OKZHLNWYFSWUMD-ISQQSFEQSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |