C18H28O3 — CID 57063601
(3aR,4S,5R,6aS)-4-(4,4-dimethyloct-2-enoyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 57063601) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-(4,4-dimethyloct-2-enoyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-4-(4,4-dimethyloct-2-enoyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 57063601 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-(4,4-dimethyloct-2-enoyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(C)C=CC(=O)[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C18H28O3/c1-5-6-8-18(3,4)9-7-14(19)17-12(2)10-15-13(17)11-16(20)21-15/h7,9,12-13,15,17H,5-6,8,10-11H2,1-4H3/t12-,13+,15+,17+/m1/s1 |
| InChIKey | SEBCCICRJSZYSQ-RMRKRWHISA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|