C17H25FO3 — CID 56989539
(3aR,4R,5R,6aS)-4-[(4R)-4-fluoro-4-methyl-3-oxooct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 56989539) has the molecular formula C17H25FO3 and a molecular weight of 296.38 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(4R)-4-fluoro-4-methyl-3-oxooct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(4R)-4-fluoro-4-methyl-3-oxooct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 56989539 |
| Molecular Formula | C17H25FO3 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(4R)-4-fluoro-4-methyl-3-oxooct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC[C@@](C)(F)C(=O)C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C17H25FO3/c1-4-5-8-17(3,18)15(19)7-6-12-11(2)9-14-13(12)10-16(20)21-14/h6-7,11-14H,4-5,8-10H2,1-3H3/t11-,12+,13-,14+,17-/m1/s1 |
| InChIKey | JJVRFEPLBWTDBE-XKSGDERDSA-N |
| XLogP | 3.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|