C21H24O11 — CID 101405796
2-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)ethanone (PubChem CID 101405796) has the molecular formula C21H24O11 and a molecular weight of 452.41 g/mol. Its IUPAC name is 2-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)ethanone.
| Compound Name | 2-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 101405796 |
| Molecular Formula | C21H24O11 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-(4-hydroxy-3-methoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)Cc2c(O)cc(O)cc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C21H24O11/c1-30-16-4-9(2-3-12(16)24)13(25)7-11-14(26)5-10(23)6-15(11)31-21-20(29)19(28)18(27)17(8-22)32-21/h2-6,17-24,26-29H,7-8H2,1H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KMLFMKXJIJIQFN-YMQHIKHWSA-N |
| XLogP | -0.58 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |