C24H37NO10 — CID 59928127
methyl 9-[(2R,5R)-4,5-dihydroxy-3-[(4-hydroxy-3-methoxybenzoyl)amino]-6-(hydroxymethyl)oxan-2-yl]oxynonanoate (PubChem CID 59928127) has the molecular formula C24H37NO10 and a molecular weight of 499.56 g/mol. Its IUPAC name is methyl 9-[(2R,5R)-4,5-dihydroxy-3-[(4-hydroxy-3-methoxybenzoyl)amino]-6-(hydroxymethyl)oxan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2R,5R)-4,5-dihydroxy-3-[(4-hydroxy-3-methoxybenzoyl)amino]-6-(hydroxymethyl)oxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 59928127 |
| Molecular Formula | C24H37NO10 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | methyl 9-[(2R,5R)-4,5-dihydroxy-3-[(4-hydroxy-3-methoxybenzoyl)amino]-6-(hydroxymethyl)oxan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@@H]1OC(CO)[C@H](O)C(O)C1NC(=O)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C24H37NO10/c1-32-17-13-15(10-11-16(17)27)23(31)25-20-22(30)21(29)18(14-26)35-24(20)34-12-8-6-4-3-5-7-9-19(28)33-2/h10-11,13,18,20-22,24,26-27,29-30H,3-9,12,14H2,1-2H3,(H,25,31)/t18?,20?,21-,22?,24+/m0/s1 |
| InChIKey | JYWAGNPXZROKNI-QNQWIWCVSA-N |
| XLogP | 0.86 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|