C24H36FNO9 — CID 91298649
methyl 9-[(2R,5S)-3-[(5-fluoro-2-hydroxybenzoyl)amino]-5-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxynonanoate (PubChem CID 91298649) has the molecular formula C24H36FNO9 and a molecular weight of 501.55 g/mol. Its IUPAC name is methyl 9-[(2R,5S)-3-[(5-fluoro-2-hydroxybenzoyl)amino]-5-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2R,5S)-3-[(5-fluoro-2-hydroxybenzoyl)amino]-5-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 91298649 |
| Molecular Formula | C24H36FNO9 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | methyl 9-[(2R,5S)-3-[(5-fluoro-2-hydroxybenzoyl)amino]-5-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@@H]1OC(CO)[C@@H](O)C(OC)C1NC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C24H36FNO9/c1-32-19(29)9-7-5-3-4-6-8-12-34-24-20(22(33-2)21(30)18(14-27)35-24)26-23(31)16-13-15(25)10-11-17(16)28/h10-11,13,18,20-22,24,27-28,30H,3-9,12,14H2,1-2H3,(H,26,31)/t18?,20?,21-,22?,24-/m1/s1 |
| InChIKey | BPCGJOOPXJONHL-RFSXTQOXSA-N |
| XLogP | 1.64 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|