C33H48N2O14 — CID 91250637
methyl 9-[(2R,5S)-6-(hydroxymethyl)-3-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-4-methoxy-5-[(5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxynonanoate (PubChem CID 91250637) has the molecular formula C33H48N2O14 and a molecular weight of 696.75 g/mol. Its IUPAC name is methyl 9-[(2R,5S)-6-(hydroxymethyl)-3-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-4-methoxy-5-[(5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2R,5S)-6-(hydroxymethyl)-3-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-4-methoxy-5-[(5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 91250637 |
| Molecular Formula | C33H48N2O14 |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.31 |
| IUPAC Name | methyl 9-[(2R,5S)-6-(hydroxymethyl)-3-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-4-methoxy-5-[(5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@@H]1OC(CO)[C@@H](OC2OC(C)[C@@H](O)C(O)C2O)C(OC)C1NC(=O)c1cc(=O)c2cccc(O)c2[nH]1 |
| InChI | InChI=1S/C33H48N2O14/c1-17-26(40)27(41)28(42)33(47-17)49-29-22(16-36)48-32(46-14-9-7-5-4-6-8-13-23(39)44-2)25(30(29)45-3)35-31(43)19-15-21(38)18-11-10-12-20(37)24(18)34-19/h10-12,15,17,22,25-30,32-33,36-37,40-42H,4-9,13-14,16H2,1-3H3,(H,34,38)(H,35,43)/t17?,22?,25?,26-,27?,28?,29-,30?,32-,33?/m1/s1 |
| InChIKey | QEMJXVIXVHUJSU-MHVLGXBNSA-N |
| XLogP | 0.20 |
| TPSA | 235.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|