C32H46N2O14 — CID 59928129
methyl 9-[(2R,5R)-4-hydroxy-6-(hydroxymethyl)-3-[(8-hydroxyquinoline-2-carbonyl)amino]-5-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxynonanoate (PubChem CID 59928129) has the molecular formula C32H46N2O14 and a molecular weight of 682.72 g/mol. Its IUPAC name is methyl 9-[(2R,5R)-4-hydroxy-6-(hydroxymethyl)-3-[(8-hydroxyquinoline-2-carbonyl)amino]-5-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2R,5R)-4-hydroxy-6-(hydroxymethyl)-3-[(8-hydroxyquinoline-2-carbonyl)amino]-5-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 59928129 |
| Molecular Formula | C32H46N2O14 |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | methyl 9-[(2R,5R)-4-hydroxy-6-(hydroxymethyl)-3-[(8-hydroxyquinoline-2-carbonyl)amino]-5-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@@H]1OC(CO)[C@H](OC2OC(CO)[C@@H](O)C(O)C2O)C(O)C1NC(=O)c1ccc2cccc(O)c2n1 |
| InChI | InChI=1S/C32H46N2O14/c1-44-22(38)11-6-4-2-3-5-7-14-45-31-24(34-30(43)18-13-12-17-9-8-10-19(37)23(17)33-18)26(40)29(21(16-36)47-31)48-32-28(42)27(41)25(39)20(15-35)46-32/h8-10,12-13,20-21,24-29,31-32,35-37,39-42H,2-7,11,14-16H2,1H3,(H,34,43)/t20?,21?,24?,25-,26?,27?,28?,29+,31-,32?/m1/s1 |
| InChIKey | BLOLKDOBKNMMBB-KSQMIRFBSA-N |
| XLogP | -0.78 |
| TPSA | 246.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|