C25H37NO10 — CID 59939231
methyl 9-[(2R,5R)-3-[(2-acetyloxybenzoyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate (PubChem CID 59939231) has the molecular formula C25H37NO10 and a molecular weight of 511.57 g/mol. Its IUPAC name is methyl 9-[(2R,5R)-3-[(2-acetyloxybenzoyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2R,5R)-3-[(2-acetyloxybenzoyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 59939231 |
| Molecular Formula | C25H37NO10 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | methyl 9-[(2R,5R)-3-[(2-acetyloxybenzoyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@@H]1OC(CO)[C@H](O)C(O)C1NC(=O)c1ccccc1OC(C)=O |
| InChI | InChI=1S/C25H37NO10/c1-16(28)35-18-12-9-8-11-17(18)24(32)26-21-23(31)22(30)19(15-27)36-25(21)34-14-10-6-4-3-5-7-13-20(29)33-2/h8-9,11-12,19,21-23,25,27,30-31H,3-7,10,13-15H2,1-2H3,(H,26,32)/t19?,21?,22-,23?,25+/m0/s1 |
| InChIKey | JYCKHJHEEJYARQ-AUFPIVKFSA-N |
| XLogP | 1.07 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|