C36H42N4O7 — CID 101405982
3-[(2S,3S,12R,13R)-8-acetyl-13-ethyl-18-methoxycarbonyl-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,12,13,22,24-hexahydroporphyrin-2-yl]propanoic acid (PubChem CID 101405982) has the molecular formula C36H42N4O7 and a molecular weight of 642.75 g/mol. Its IUPAC name is 3-[(2S,3S,12R,13R)-8-acetyl-13-ethyl-18-methoxycarbonyl-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,12,13,22,24-hexahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,3S,12R,13R)-8-acetyl-13-ethyl-18-methoxycarbonyl-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,12,13,22,24-hexahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 101405982 |
| Molecular Formula | C36H42N4O7 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | 3-[(2S,3S,12R,13R)-8-acetyl-13-ethyl-18-methoxycarbonyl-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,12,13,22,24-hexahydroporphyrin-2-yl]propanoic acid |
| SMILES | CC[C@H]1c2cc3[nH]c(c(CC(=O)OC)c4nc(cc5[nH]c(cc(n2)[C@@H]1C)c(C(C)=O)c5C)[C@@H](C)[C@@H]4CCC(=O)O)c(C(=O)OC)c3C |
| InChI | InChI=1S/C36H42N4O7/c1-9-21-16(2)24-15-29-32(20(6)41)18(4)26(38-29)13-25-17(3)22(10-11-30(42)43)34(39-25)23(12-31(44)46-7)35-33(36(45)47-8)19(5)27(40-35)14-28(21)37-24/h13-17,21-22,38,40H,9-12H2,1-8H3,(H,42,43)/b24-15-,25-13-,26-13-,27-14-,28-14-,29-15-,34-23-,35-23-/t16-,17+,21-,22+/m1/s1 |
| InChIKey | YNPLRPMQWMUWCK-BRUGMBFPSA-N |
| XLogP | 6.69 |
| TPSA | 164.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |