C41H52N4O7 — CID 11563892
propyl (7R,8R,17S,18S)-12-acetyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-18-(3-oxo-3-propoxypropyl)-7,8,17,18,21,23-hexahydroporphyrin-2-carboxylate (PubChem CID 11563892) has the molecular formula C41H52N4O7 and a molecular weight of 712.89 g/mol. Its IUPAC name is propyl (7R,8R,17S,18S)-12-acetyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-18-(3-oxo-3-propoxypropyl)-7,8,17,18,21,23-hexahydroporphyrin-2-carboxylate.
| Compound Name | propyl (7R,8R,17S,18S)-12-acetyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-18-(3-oxo-3-propoxypropyl)-7,8,17,18,21,23-hexahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 11563892 |
| Molecular Formula | C41H52N4O7 |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | propyl (7R,8R,17S,18S)-12-acetyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-18-(3-oxo-3-propoxypropyl)-7,8,17,18,21,23-hexahydroporphyrin-2-carboxylate |
| SMILES | CCCOC(=O)CC[C@@H]1c2nc(cc3[nH]c(cc4nc(cc5[nH]c(c2CC(=O)OC)c(C(=O)OCCC)c5C)[C@H](CC)[C@H]4C)c(C(C)=O)c3C)[C@H]1C |
| InChI | InChI=1S/C41H52N4O7/c1-10-15-51-35(47)14-13-27-22(5)30-18-31-23(6)37(25(8)46)34(43-31)20-29-21(4)26(12-3)33(42-29)19-32-24(7)38(41(49)52-16-11-2)40(45-32)28(39(27)44-30)17-36(48)50-9/h18-22,26-27,43,45H,10-17H2,1-9H3/b29-20-,30-18-,31-18-,32-19-,33-19-,34-20-,39-28-,40-28-/t21-,22+,26-,27+/m1/s1 |
| InChIKey | DDTWKAWGEPXHKV-LFRARYMUSA-N |
| XLogP | 8.33 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|