C27H37N2O3+ — CID 101406229
[2-[4-(dimethylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]-dimethyl-octylazanium (PubChem CID 101406229) has the molecular formula C27H37N2O3+ and a molecular weight of 437.60 g/mol. Its IUPAC name is [2-[4-(dimethylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]-dimethyl-octylazanium.
| Compound Name | [2-[4-(dimethylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]-dimethyl-octylazanium |
|---|---|
| PubChem CID | 101406229 |
| Molecular Formula | C27H37N2O3+ |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [2-[4-(dimethylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]-dimethyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(C)c1ccc2oc(-c3ccc(N(C)C)cc3)c(O)c(=O)c2c1 |
| InChI | InChI=1S/C27H36N2O3/c1-6-7-8-9-10-11-18-29(4,5)22-16-17-24-23(19-22)25(30)26(31)27(32-24)20-12-14-21(15-13-20)28(2)3/h12-17,19H,6-11,18H2,1-5H3/p+1 |
| InChIKey | BXDBHMBVPRDRHF-UHFFFAOYSA-O |
| XLogP | 6.16 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|