C37H57N2O6S+ — CID 177452451
[2-[4-(dioctylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]methyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 177452451) has the molecular formula C37H57N2O6S+ and a molecular weight of 657.94 g/mol. Its IUPAC name is [2-[4-(dioctylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]methyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | [2-[4-(dioctylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]methyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 177452451 |
| Molecular Formula | C37H57N2O6S+ |
| Molecular Weight | 657.94 g/mol |
| Exact Mass | 657.39 |
| IUPAC Name | [2-[4-(dioctylamino)phenyl]-3-hydroxy-4-oxochromen-6-yl]methyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(-c2oc3ccc(C[N+](C)(C)CCCS(=O)(=O)O)cc3c(=O)c2O)cc1 |
| InChI | InChI=1S/C37H56N2O6S/c1-5-7-9-11-13-15-24-38(25-16-14-12-10-8-6-2)32-21-19-31(20-22-32)37-36(41)35(40)33-28-30(18-23-34(33)45-37)29-39(3,4)26-17-27-46(42,43)44/h18-23,28H,5-17,24-27,29H2,1-4H3,(H-,41,42,43,44)/p+1 |
| InChIKey | SIWKBWGDAISQOF-UHFFFAOYSA-O |
| XLogP | 8.55 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.94 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|