C22H32N2O4 — CID 101408156
[(1S,7R,11R)-8,11-dimethyl-3,5-dioxo-4-(3-piperidin-1-ylpropyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate (PubChem CID 101408156) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [(1S,7R,11R)-8,11-dimethyl-3,5-dioxo-4-(3-piperidin-1-ylpropyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate.
| Compound Name | [(1S,7R,11R)-8,11-dimethyl-3,5-dioxo-4-(3-piperidin-1-ylpropyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate |
|---|---|
| PubChem CID | 101408156 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [(1S,7R,11R)-8,11-dimethyl-3,5-dioxo-4-(3-piperidin-1-ylpropyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12C=C(C)[C@@H](C3C(=O)N(CCCN4CCCCC4)C(=O)C31)[C@H](C)C2 |
| InChI | InChI=1S/C22H32N2O4/c1-14-12-22(28-16(3)25)13-15(2)17(14)18-19(22)21(27)24(20(18)26)11-7-10-23-8-5-4-6-9-23/h12,15,17-19H,4-11,13H2,1-3H3/t15-,17-,18?,19?,22-/m1/s1 |
| InChIKey | GDGACWZMOHJFET-BGZHRWQCSA-N |
| XLogP | 2.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|