C18H24Br2O — CID 101408171
1,3-bis[(Z)-2-bromoethenyl]-5-octoxybenzene (PubChem CID 101408171) has the molecular formula C18H24Br2O and a molecular weight of 416.20 g/mol. Its IUPAC name is 1,3-bis[(Z)-2-bromoethenyl]-5-octoxybenzene.
| Compound Name | 1,3-bis[(Z)-2-bromoethenyl]-5-octoxybenzene |
|---|---|
| PubChem CID | 101408171 |
| Molecular Formula | C18H24Br2O |
| Molecular Weight | 416.20 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 1,3-bis[(Z)-2-bromoethenyl]-5-octoxybenzene |
| SMILES | CCCCCCCCOc1cc(/C=C\Br)cc(/C=C\Br)c1 |
| InChI | InChI=1S/C18H24Br2O/c1-2-3-4-5-6-7-12-21-18-14-16(8-10-19)13-17(15-18)9-11-20/h8-11,13-15H,2-7,12H2,1H3/b10-8-,11-9- |
| InChIKey | OUCLWKXOMAAZKO-WGEIWTTOSA-N |
| XLogP | 7.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.20 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|