C59H108N3O4+3 — CID 155767426
6-[3-[(E)-2-[3,5-bis[6-[hexyl(dimethyl)azaniumyl]hexoxy]phenyl]ethenyl]-5-propoxyphenoxy]hexyl-hexyl-dimethylazanium (PubChem CID 155767426) has the molecular formula C59H108N3O4+3 and a molecular weight of 923.53 g/mol. Its IUPAC name is 6-[3-[(E)-2-[3,5-bis[6-[hexyl(dimethyl)azaniumyl]hexoxy]phenyl]ethenyl]-5-propoxyphenoxy]hexyl-hexyl-dimethylazanium.
| Compound Name | 6-[3-[(E)-2-[3,5-bis[6-[hexyl(dimethyl)azaniumyl]hexoxy]phenyl]ethenyl]-5-propoxyphenoxy]hexyl-hexyl-dimethylazanium |
|---|---|
| PubChem CID | 155767426 |
| Molecular Formula | C59H108N3O4+3 |
| Molecular Weight | 923.53 g/mol |
| Exact Mass | 922.83 |
| IUPAC Name | 6-[3-[(E)-2-[3,5-bis[6-[hexyl(dimethyl)azaniumyl]hexoxy]phenyl]ethenyl]-5-propoxyphenoxy]hexyl-hexyl-dimethylazanium |
| SMILES | CCCCCC[N+](C)(C)CCCCCCOc1cc(/C=C/c2cc(OCCCCCC[N+](C)(C)CCCCCC)cc(OCCCCCC[N+](C)(C)CCCCCC)c2)cc(OCCC)c1 |
| InChI | InChI=1S/C59H108N3O4/c1-11-15-18-27-38-60(5,6)41-30-21-24-33-45-64-57-49-54(48-56(52-57)63-44-14-4)36-37-55-50-58(65-46-34-25-22-31-42-61(7,8)39-28-19-16-12-2)53-59(51-55)66-47-35-26-23-32-43-62(9,10)40-29-20-17-13-3/h36-37,48-53H,11-35,38-47H2,1-10H3/q+3/b37-36+ |
| InChIKey | GLNRIUHRVWQOQX-BSRQYYOTSA-N |
| XLogP | 15.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.53 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|