C25H46N4O7S — CID 101408971
(2S,3S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-6-(8-sulfanyloctanoylamino)hexanoyl]amino]-3-methylpentanoic acid (PubChem CID 101408971) has the molecular formula C25H46N4O7S and a molecular weight of 546.73 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-6-(8-sulfanyloctanoylamino)hexanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-6-(8-sulfanyloctanoylamino)hexanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 101408971 |
| Molecular Formula | C25H46N4O7S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-6-(8-sulfanyloctanoylamino)hexanoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCNC(=O)CCCCCCCS)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H46N4O7S/c1-3-17(2)22(25(35)36)29-24(34)19(28-23(33)18(26)13-14-21(31)32)11-8-9-15-27-20(30)12-7-5-4-6-10-16-37/h17-19,22,37H,3-16,26H2,1-2H3,(H,27,30)(H,28,33)(H,29,34)(H,31,32)(H,35,36)/t17-,18-,19-,22-/m0/s1 |
| InChIKey | XQFPEJNXVCPJGI-OZIGNCPNSA-N |
| XLogP | 1.84 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|