C20H30O4 — CID 101410257
(4E,8E,12E,15E,18E)-6-hydroperoxyicosa-4,8,12,15,18-pentaenoic acid (PubChem CID 101410257) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4E,8E,12E,15E,18E)-6-hydroperoxyicosa-4,8,12,15,18-pentaenoic acid.
| Compound Name | (4E,8E,12E,15E,18E)-6-hydroperoxyicosa-4,8,12,15,18-pentaenoic acid |
|---|---|
| PubChem CID | 101410257 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4E,8E,12E,15E,18E)-6-hydroperoxyicosa-4,8,12,15,18-pentaenoic acid |
| SMILES | C/C=C/C/C=C/C/C=C/CC/C=C/CC(/C=C/CCC(=O)O)OO |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19(24-23)17-14-15-18-20(21)22/h2-3,5-6,8-9,12-14,17,19,23H,4,7,10-11,15-16,18H2,1H3,(H,21,22)/b3-2+,6-5+,9-8+,13-12+,17-14+ |
| InChIKey | UEOIFEYGBYCQOO-LAFWNVSYSA-N |
| XLogP | 5.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|