C19H42O4Si2 — CID 101410817
(2S,3S)-4,4-dimethyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silylperoxypentanal (PubChem CID 101410817) has the molecular formula C19H42O4Si2 and a molecular weight of 390.71 g/mol. Its IUPAC name is (2S,3S)-4,4-dimethyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silylperoxypentanal.
| Compound Name | (2S,3S)-4,4-dimethyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silylperoxypentanal |
|---|---|
| PubChem CID | 101410817 |
| Molecular Formula | C19H42O4Si2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (2S,3S)-4,4-dimethyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silylperoxypentanal |
| SMILES | CC(C)[Si](OO[C@H](C=O)[C@@H](O[Si](C)(C)C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H42O4Si2/c1-14(2)25(15(3)4,16(5)6)23-21-17(13-20)18(19(7,8)9)22-24(10,11)12/h13-18H,1-12H3/t17-,18-/m1/s1 |
| InChIKey | RDXKMYMZFANYJF-QZTJIDSGSA-N |
| XLogP | 5.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|