C16H34O4Si — CID 11954589
(2S,3S)-3-hydroxy-4,4-dimethyl-2-tri(propan-2-yl)silylperoxypentanal (PubChem CID 11954589) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-4,4-dimethyl-2-tri(propan-2-yl)silylperoxypentanal.
| Compound Name | (2S,3S)-3-hydroxy-4,4-dimethyl-2-tri(propan-2-yl)silylperoxypentanal |
|---|---|
| PubChem CID | 11954589 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S,3S)-3-hydroxy-4,4-dimethyl-2-tri(propan-2-yl)silylperoxypentanal |
| SMILES | CC(C)[Si](OO[C@H](C=O)[C@@H](O)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O4Si/c1-11(2)21(12(3)4,13(5)6)20-19-14(10-17)15(18)16(7,8)9/h10-15,18H,1-9H3/t14-,15-/m1/s1 |
| InChIKey | VEDVQFXLMLJBNQ-HUUCEWRRSA-N |
| XLogP | 4.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|