C18H20O3 — CID 101410966
(1R,3S,4R,5R,7S)-7-(hydroxymethyl)-4-methyl-3-[(E)-2-phenylethenyl]bicyclo[3.2.1]octane-2,6-dione (PubChem CID 101410966) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1R,3S,4R,5R,7S)-7-(hydroxymethyl)-4-methyl-3-[(E)-2-phenylethenyl]bicyclo[3.2.1]octane-2,6-dione.
| Compound Name | (1R,3S,4R,5R,7S)-7-(hydroxymethyl)-4-methyl-3-[(E)-2-phenylethenyl]bicyclo[3.2.1]octane-2,6-dione |
|---|---|
| PubChem CID | 101410966 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1R,3S,4R,5R,7S)-7-(hydroxymethyl)-4-methyl-3-[(E)-2-phenylethenyl]bicyclo[3.2.1]octane-2,6-dione |
| SMILES | C[C@H]1[C@H](/C=C/c2ccccc2)C(=O)[C@@H]2C[C@H]1C(=O)[C@@H]2CO |
| InChI | InChI=1S/C18H20O3/c1-11-13(8-7-12-5-3-2-4-6-12)17(20)15-9-14(11)18(21)16(15)10-19/h2-8,11,13-16,19H,9-10H2,1H3/b8-7+/t11-,13-,14+,15+,16+/m0/s1 |
| InChIKey | NKJBIODKJGWFFQ-PMEWQSCGSA-N |
| XLogP | 2.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |