C15H18O2 — CID 138980990
(1R,3R,4S,5S)-4-hydroxy-3-methyl-1-phenylbicyclo[3.2.1]octan-8-one (PubChem CID 138980990) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (1R,3R,4S,5S)-4-hydroxy-3-methyl-1-phenylbicyclo[3.2.1]octan-8-one.
| Compound Name | (1R,3R,4S,5S)-4-hydroxy-3-methyl-1-phenylbicyclo[3.2.1]octan-8-one |
|---|---|
| PubChem CID | 138980990 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (1R,3R,4S,5S)-4-hydroxy-3-methyl-1-phenylbicyclo[3.2.1]octan-8-one |
| SMILES | C[C@@H]1C[C@@]2(c3ccccc3)CC[C@H](C2=O)[C@H]1O |
| InChI | InChI=1S/C15H18O2/c1-10-9-15(11-5-3-2-4-6-11)8-7-12(13(10)16)14(15)17/h2-6,10,12-13,16H,7-9H2,1H3/t10-,12+,13+,15-/m1/s1 |
| InChIKey | SYZXFHAFNMJCPO-GVUJHPQVSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |