C18H24O2 — CID 71696963
(1R,3aR,4S,7aR)-4-benzyl-1-hydroxy-4,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-5-one (PubChem CID 71696963) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-4-benzyl-1-hydroxy-4,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-5-one.
| Compound Name | (1R,3aR,4S,7aR)-4-benzyl-1-hydroxy-4,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-5-one |
|---|---|
| PubChem CID | 71696963 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (1R,3aR,4S,7aR)-4-benzyl-1-hydroxy-4,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-5-one |
| SMILES | C[C@@]12CCC(=O)[C@@](C)(Cc3ccccc3)[C@@H]1CC[C@H]2O |
| InChI | InChI=1S/C18H24O2/c1-17-11-10-16(20)18(2,14(17)8-9-15(17)19)12-13-6-4-3-5-7-13/h3-7,14-15,19H,8-12H2,1-2H3/t14-,15-,17-,18+/m1/s1 |
| InChIKey | CQRLLCDPFBEFAS-AHCXZYCDSA-N |
| XLogP | 3.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |