C28H29NO — CID 101414265
1-[(4-tert-butylphenyl)methyl]-3,3-diphenyl-2H-pyridin-6-one (PubChem CID 101414265) has the molecular formula C28H29NO and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3,3-diphenyl-2H-pyridin-6-one.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3,3-diphenyl-2H-pyridin-6-one |
|---|---|
| PubChem CID | 101414265 |
| Molecular Formula | C28H29NO |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3,3-diphenyl-2H-pyridin-6-one |
| SMILES | CC(C)(C)c1ccc(CN2CC(c3ccccc3)(c3ccccc3)C=CC2=O)cc1 |
| InChI | InChI=1S/C28H29NO/c1-27(2,3)23-16-14-22(15-17-23)20-29-21-28(19-18-26(29)30,24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-19H,20-21H2,1-3H3 |
| InChIKey | OFWRUJZHNRLELC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |