C12H20N2O5S — CID 101414397
ethyl N-(ethoxycarbonylamino)-N-[(E,2R)-1-methylsulfanyl-5-oxopent-3-en-2-yl]carbamate (PubChem CID 101414397) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is ethyl N-(ethoxycarbonylamino)-N-[(E,2R)-1-methylsulfanyl-5-oxopent-3-en-2-yl]carbamate.
| Compound Name | ethyl N-(ethoxycarbonylamino)-N-[(E,2R)-1-methylsulfanyl-5-oxopent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 101414397 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | ethyl N-(ethoxycarbonylamino)-N-[(E,2R)-1-methylsulfanyl-5-oxopent-3-en-2-yl]carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@H](/C=C/C=O)CSC |
| InChI | InChI=1S/C12H20N2O5S/c1-4-18-11(16)13-14(12(17)19-5-2)10(9-20-3)7-6-8-15/h6-8,10H,4-5,9H2,1-3H3,(H,13,16)/b7-6+/t10-/m1/s1 |
| InChIKey | BYKYEVGQYOYAEN-VQCYPWCPSA-N |
| XLogP | 1.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|