C18H16FNO — CID 101414861
1-benzyl-4-(4-fluorophenyl)-2,6-dihydropyridin-3-one (PubChem CID 101414861) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-benzyl-4-(4-fluorophenyl)-2,6-dihydropyridin-3-one.
| Compound Name | 1-benzyl-4-(4-fluorophenyl)-2,6-dihydropyridin-3-one |
|---|---|
| PubChem CID | 101414861 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-benzyl-4-(4-fluorophenyl)-2,6-dihydropyridin-3-one |
| SMILES | O=C1CN(Cc2ccccc2)CC=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO/c19-16-8-6-15(7-9-16)17-10-11-20(13-18(17)21)12-14-4-2-1-3-5-14/h1-10H,11-13H2 |
| InChIKey | NAJGSIUVRHFSKZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |