C26H21N5O4S — CID 10141700
8-[(3-methylbenzoyl)amino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide (PubChem CID 10141700) has the molecular formula C26H21N5O4S and a molecular weight of 499.55 g/mol. Its IUPAC name is 8-[(3-methylbenzoyl)amino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(3-methylbenzoyl)amino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10141700 |
| Molecular Formula | C26H21N5O4S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 8-[(3-methylbenzoyl)amino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc3ccc4c(C(N)=O)nn(-c5ccc(S(N)(=O)=O)cc5)c4c3c2)c1 |
| InChI | InChI=1S/C26H21N5O4S/c1-15-3-2-4-17(13-15)26(33)29-18-7-5-16-6-12-21-23(25(27)32)30-31(24(21)22(16)14-18)19-8-10-20(11-9-19)36(28,34)35/h2-14H,1H3,(H2,27,32)(H,29,33)(H2,28,34,35) |
| InChIKey | RVNAKHRUZLIOEG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |