C20H27NO4S — CID 101417563
N-[(3S,4R)-1-hydroxy-4-phenylmethoxyhexan-3-yl]-4-methylbenzenesulfonamide (PubChem CID 101417563) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[(3S,4R)-1-hydroxy-4-phenylmethoxyhexan-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3S,4R)-1-hydroxy-4-phenylmethoxyhexan-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101417563 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(3S,4R)-1-hydroxy-4-phenylmethoxyhexan-3-yl]-4-methylbenzenesulfonamide |
| SMILES | CC[C@@H](OCc1ccccc1)[C@H](CCO)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-3-20(25-15-17-7-5-4-6-8-17)19(13-14-22)21-26(23,24)18-11-9-16(2)10-12-18/h4-12,19-22H,3,13-15H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | RNTSFQNMYKCWBI-VQTJNVASSA-N |
| XLogP | 3.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |