C29H45NO4SSi — CID 101417564
N-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhexan-3-yl]-4-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 101417564) has the molecular formula C29H45NO4SSi and a molecular weight of 531.84 g/mol. Its IUPAC name is N-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhexan-3-yl]-4-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhexan-3-yl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 101417564 |
| Molecular Formula | C29H45NO4SSi |
| Molecular Weight | 531.84 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | N-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhexan-3-yl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN([C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](CC)OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H45NO4SSi/c1-9-21-30(35(31,32)26-18-16-24(3)17-19-26)27(20-22-34-36(7,8)29(4,5)6)28(10-2)33-23-25-14-12-11-13-15-25/h9,11-19,27-28H,1,10,20-23H2,2-8H3/t27-,28+/m0/s1 |
| InChIKey | OTBXFZKWFXAONT-WUFINQPMSA-N |
| XLogP | 6.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|